C19H28N2 — CID 176760810
1,3-bis[(2Z,4Z)-6-methylhepta-2,4,6-trien-3-yl]imidazolidine (PubChem CID 176760810) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 1,3-bis[(2Z,4Z)-6-methylhepta-2,4,6-trien-3-yl]imidazolidine.
| Compound Name | 1,3-bis[(2Z,4Z)-6-methylhepta-2,4,6-trien-3-yl]imidazolidine |
|---|---|
| PubChem CID | 176760810 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 1,3-bis[(2Z,4Z)-6-methylhepta-2,4,6-trien-3-yl]imidazolidine |
| SMILES | C=C(C)/C=C\C(=C\C)N1CCN(C(/C=C\C(=C)C)=C\C)C1 |
| InChI | InChI=1S/C19H28N2/c1-7-18(11-9-16(3)4)20-13-14-21(15-20)19(8-2)12-10-17(5)6/h7-12H,3,5,13-15H2,1-2,4,6H3/b11-9-,12-10-,18-7-,19-8- |
| InChIKey | WMPWXMJYUHKPNO-MHFNOWPGSA-N |
| XLogP | 4.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|