C15H25N3O3S — CID 142188982
N-[(3S)-1-(2-methanethioylhydrazinyl)-1,2-dioxoheptan-3-yl]cyclohexanecarboxamide (PubChem CID 142188982) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is N-[(3S)-1-(2-methanethioylhydrazinyl)-1,2-dioxoheptan-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[(3S)-1-(2-methanethioylhydrazinyl)-1,2-dioxoheptan-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 142188982 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[(3S)-1-(2-methanethioylhydrazinyl)-1,2-dioxoheptan-3-yl]cyclohexanecarboxamide |
| SMILES | CCCC[C@H](NC(=O)C1CCCCC1)C(=O)C(=O)NNC=S |
| InChI | InChI=1S/C15H25N3O3S/c1-2-3-9-12(13(19)15(21)18-16-10-22)17-14(20)11-7-5-4-6-8-11/h10-12H,2-9H2,1H3,(H,16,22)(H,17,20)(H,18,21)/t12-/m0/s1 |
| InChIKey | CWNFKQZBPQDYHQ-LBPRGKRZSA-N |
| XLogP | 1.39 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|