C12H17NO — CID 142189103
(2Z,3Z)-2-(1-ethoxypropylidene)-3-ethylidenepyridine (PubChem CID 142189103) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (2Z,3Z)-2-(1-ethoxypropylidene)-3-ethylidenepyridine.
| Compound Name | (2Z,3Z)-2-(1-ethoxypropylidene)-3-ethylidenepyridine |
|---|---|
| PubChem CID | 142189103 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (2Z,3Z)-2-(1-ethoxypropylidene)-3-ethylidenepyridine |
| SMILES | C/C=c1/cccn/c1=C(/CC)OCC |
| InChI | InChI=1S/C12H17NO/c1-4-10-8-7-9-13-12(10)11(5-2)14-6-3/h4,7-9H,5-6H2,1-3H3/b10-4-,12-11- |
| InChIKey | IXGCGVOOSZFOTL-LSHQYWQOSA-N |
| XLogP | 1.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |