C14H15FO — CID 142189173
1-fluoro-3-[[(1Z,3Z)-3-methylhexa-1,3,5-trienoxy]methyl]benzene (PubChem CID 142189173) has the molecular formula C14H15FO and a molecular weight of 218.27 g/mol. Its IUPAC name is 1-fluoro-3-[[(1Z,3Z)-3-methylhexa-1,3,5-trienoxy]methyl]benzene.
| Compound Name | 1-fluoro-3-[[(1Z,3Z)-3-methylhexa-1,3,5-trienoxy]methyl]benzene |
|---|---|
| PubChem CID | 142189173 |
| Molecular Formula | C14H15FO |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-fluoro-3-[[(1Z,3Z)-3-methylhexa-1,3,5-trienoxy]methyl]benzene |
| SMILES | C=C/C=C(C)\C=C/OCc1cccc(F)c1 |
| InChI | InChI=1S/C14H15FO/c1-3-5-12(2)8-9-16-11-13-6-4-7-14(15)10-13/h3-10H,1,11H2,2H3/b9-8-,12-5- |
| InChIKey | AXFMHOYBIZJFPH-UUBDPURSSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|