C18H18FNO2 — CID 91402188
N-(3,4-dimethylphenyl)-3-[(3-fluorophenyl)methoxy]prop-2-enamide (PubChem CID 91402188) has the molecular formula C18H18FNO2 and a molecular weight of 299.34 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-3-[(3-fluorophenyl)methoxy]prop-2-enamide.
| Compound Name | N-(3,4-dimethylphenyl)-3-[(3-fluorophenyl)methoxy]prop-2-enamide |
|---|---|
| PubChem CID | 91402188 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-(3,4-dimethylphenyl)-3-[(3-fluorophenyl)methoxy]prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)C=COCc2cccc(F)c2)cc1C |
| InChI | InChI=1S/C18H18FNO2/c1-13-6-7-17(10-14(13)2)20-18(21)8-9-22-12-15-4-3-5-16(19)11-15/h3-11H,12H2,1-2H3,(H,20,21) |
| InChIKey | PEELIQYLTQSHGQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|