About 1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane
1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane (PubChem CID 142190190) has the molecular formula C20H46
and a molecular weight of 286.59 g/mol. Its IUPAC name is 1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane.
Molecular Properties
| Compound Name | 1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane |
| PubChem CID | 142190190 |
| Molecular Formula | C20H46 |
| Molecular Weight | 286.59 g/mol |
| Exact Mass | 286.36 |
| IUPAC Name | 1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane |
| SMILES | CC.CC.CCC.CCCCC1CC1CC(C)CCC |
| InChI | InChI=1S/C13H26.C3H8.2C2H6/c1-4-6-8-12-10-13(12)9-11(3)7-5-2;1-3-2;2*1-2/h11-13H,4-10H2,1-3H3;3H2,1-2H3;2*1-2H3 |
| InChIKey | WYACBEZKJKASAA-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.59 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane?
The IUPAC name of 1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane (CID 142190190) is 1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane.
What is the SMILES notation for 1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane?
The canonical SMILES for 1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane is CC.CC.CCC.CCCCC1CC1CC(C)CCC.
What is the InChIKey of 1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane?
The InChIKey is WYACBEZKJKASAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26.C3H8.2C2H6/c1-4-6-8-12-10-13(12)9-11(3)7-5-2;1-3-2;2*1-2/h11-13H,4-10H2,1-3H3;3H2,1-2H3;2*1-2H3.
What are the key properties of 1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane?
1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane has a molecular weight of 286.59 g/mol, XLogP of 8.11, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-(2-methylpentyl)cyclopropane;ethane;propane is sourced from PubChem (CID 142190190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).