C29H27N3O3S — CID 142190928
3-[3-[3-[4-methyl-2-(4-methylphenyl)-1,3-thiazole-5-carboximidoyl]-2,4-dihydro-1,3-benzoxazin-6-yl]phenyl]propanoic acid (PubChem CID 142190928) has the molecular formula C29H27N3O3S and a molecular weight of 497.62 g/mol. Its IUPAC name is 3-[3-[3-[4-methyl-2-(4-methylphenyl)-1,3-thiazole-5-carboximidoyl]-2,4-dihydro-1,3-benzoxazin-6-yl]phenyl]propanoic acid.
| Compound Name | 3-[3-[3-[4-methyl-2-(4-methylphenyl)-1,3-thiazole-5-carboximidoyl]-2,4-dihydro-1,3-benzoxazin-6-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 142190928 |
| Molecular Formula | C29H27N3O3S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 3-[3-[3-[4-methyl-2-(4-methylphenyl)-1,3-thiazole-5-carboximidoyl]-2,4-dihydro-1,3-benzoxazin-6-yl]phenyl]propanoic acid |
| SMILES | [H]/N=C(/c1sc(-c2ccc(C)cc2)nc1C)N1COc2ccc(-c3cccc(CCC(=O)O)c3)cc2C1 |
| InChI | InChI=1S/C29H27N3O3S/c1-18-6-9-21(10-7-18)29-31-19(2)27(36-29)28(30)32-16-24-15-23(11-12-25(24)35-17-32)22-5-3-4-20(14-22)8-13-26(33)34/h3-7,9-12,14-15,30H,8,13,16-17H2,1-2H3,(H,33,34)/b30-28- |
| InChIKey | RGTKEBGYKYARKL-HYOGKJQXSA-N |
| XLogP | 6.29 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|