C14H24N2 — CID 142191153
(3R)-3-methyl-N-[(Z)-pent-3-en-2-yl]-4-prop-2-enyl-1,2,3,6-tetrahydropyridin-5-amine (PubChem CID 142191153) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (3R)-3-methyl-N-[(Z)-pent-3-en-2-yl]-4-prop-2-enyl-1,2,3,6-tetrahydropyridin-5-amine.
| Compound Name | (3R)-3-methyl-N-[(Z)-pent-3-en-2-yl]-4-prop-2-enyl-1,2,3,6-tetrahydropyridin-5-amine |
|---|---|
| PubChem CID | 142191153 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (3R)-3-methyl-N-[(Z)-pent-3-en-2-yl]-4-prop-2-enyl-1,2,3,6-tetrahydropyridin-5-amine |
| SMILES | C=CCC1=C(NC(C)/C=C\C)CNC[C@@H]1C |
| InChI | InChI=1S/C14H24N2/c1-5-7-12(4)16-14-10-15-9-11(3)13(14)8-6-2/h5-7,11-12,15-16H,2,8-10H2,1,3-4H3/b7-5-/t11-,12?/m0/s1 |
| InChIKey | QWXGWYORLDQWKY-USVMZGSESA-N |
| XLogP | 2.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|