C30H38FNO4 — CID 142191343
(E,3R,5S)-7-[4-(4-fluorophenyl)-9-methylidene-2-propan-2-yl-5,6,7,8-tetrahydrocyclohepta[b]pyridin-3-yl]-3,5-dihydroxyhept-6-enoic acid;prop-1-ene (PubChem CID 142191343) has the molecular formula C30H38FNO4 and a molecular weight of 495.64 g/mol. Its IUPAC name is (E,3R,5S)-7-[4-(4-fluorophenyl)-9-methylidene-2-propan-2-yl-5,6,7,8-tetrahydrocyclohepta[b]pyridin-3-yl]-3,5-dihydroxyhept-6-enoic acid;prop-1-ene.
| Compound Name | (E,3R,5S)-7-[4-(4-fluorophenyl)-9-methylidene-2-propan-2-yl-5,6,7,8-tetrahydrocyclohepta[b]pyridin-3-yl]-3,5-dihydroxyhept-6-enoic acid;prop-1-ene |
|---|---|
| PubChem CID | 142191343 |
| Molecular Formula | C30H38FNO4 |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | (E,3R,5S)-7-[4-(4-fluorophenyl)-9-methylidene-2-propan-2-yl-5,6,7,8-tetrahydrocyclohepta[b]pyridin-3-yl]-3,5-dihydroxyhept-6-enoic acid;prop-1-ene |
| SMILES | C=C1CCCCc2c1nc(C(C)C)c(/C=C/[C@@H](O)C[C@@H](O)CC(=O)O)c2-c1ccc(F)cc1.C=CC |
| InChI | InChI=1S/C27H32FNO4.C3H6/c1-16(2)26-23(13-12-20(30)14-21(31)15-24(32)33)25(18-8-10-19(28)11-9-18)22-7-5-4-6-17(3)27(22)29-26;1-3-2/h8-13,16,20-21,30-31H,3-7,14-15H2,1-2H3,(H,32,33);3H,1H2,2H3/b13-12+;/t20-,21-;/m1./s1 |
| InChIKey | AEMPEQFNZXMZSC-VRHXWEEISA-N |
| XLogP | 6.54 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|