C24H29FN2O7S — CID 69310225
(3R,5S)-7-[5-(4-fluorophenyl)-1-methylsulfonyl-7-propan-2-yl-2,4-dihydropyrido[2,3-d][1,3]oxazin-6-yl]-3,5-dihydroxyhept-6-enoic acid (PubChem CID 69310225) has the molecular formula C24H29FN2O7S and a molecular weight of 508.57 g/mol. Its IUPAC name is (3R,5S)-7-[5-(4-fluorophenyl)-1-methylsulfonyl-7-propan-2-yl-2,4-dihydropyrido[2,3-d][1,3]oxazin-6-yl]-3,5-dihydroxyhept-6-enoic acid.
| Compound Name | (3R,5S)-7-[5-(4-fluorophenyl)-1-methylsulfonyl-7-propan-2-yl-2,4-dihydropyrido[2,3-d][1,3]oxazin-6-yl]-3,5-dihydroxyhept-6-enoic acid |
|---|---|
| PubChem CID | 69310225 |
| Molecular Formula | C24H29FN2O7S |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | (3R,5S)-7-[5-(4-fluorophenyl)-1-methylsulfonyl-7-propan-2-yl-2,4-dihydropyrido[2,3-d][1,3]oxazin-6-yl]-3,5-dihydroxyhept-6-enoic acid |
| SMILES | CC(C)c1nc2c(c(-c3ccc(F)cc3)c1C=C[C@@H](O)C[C@@H](O)CC(=O)O)COCN2S(C)(=O)=O |
| InChI | InChI=1S/C24H29FN2O7S/c1-14(2)23-19(9-8-17(28)10-18(29)11-21(30)31)22(15-4-6-16(25)7-5-15)20-12-34-13-27(24(20)26-23)35(3,32)33/h4-9,14,17-18,28-29H,10-13H2,1-3H3,(H,30,31)/t17-,18-/m1/s1 |
| InChIKey | QURKJRYZUHYGPT-QZTJIDSGSA-N |
| XLogP | 2.86 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |