C24H28FN2NaO6S — CID 23667950
sodium (E,3R,5S)-7-[5-(4-fluorophenyl)-1-methyl-2,2-dioxo-7-propan-2-yl-3,4-dihydropyrido[2,3-c]thiazin-6-yl]-3,5-dihydroxyhept-6-enoate (PubChem CID 23667950) has the molecular formula C24H28FN2NaO6S and a molecular weight of 514.55 g/mol. Its IUPAC name is sodium (E,3R,5S)-7-[5-(4-fluorophenyl)-1-methyl-2,2-dioxo-7-propan-2-yl-3,4-dihydropyrido[2,3-c]thiazin-6-yl]-3,5-dihydroxyhept-6-enoate.
| Compound Name | sodium (E,3R,5S)-7-[5-(4-fluorophenyl)-1-methyl-2,2-dioxo-7-propan-2-yl-3,4-dihydropyrido[2,3-c]thiazin-6-yl]-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 23667950 |
| Molecular Formula | C24H28FN2NaO6S |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | sodium (E,3R,5S)-7-[5-(4-fluorophenyl)-1-methyl-2,2-dioxo-7-propan-2-yl-3,4-dihydropyrido[2,3-c]thiazin-6-yl]-3,5-dihydroxyhept-6-enoate |
| SMILES | CC(C)c1nc2c(c(-c3ccc(F)cc3)c1/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])CCS(=O)(=O)N2C.[Na+] |
| InChI | InChI=1S/C24H29FN2O6S.Na/c1-14(2)23-19(9-8-17(28)12-18(29)13-21(30)31)22(15-4-6-16(25)7-5-15)20-10-11-34(32,33)27(3)24(20)26-23;/h4-9,14,17-18,28-29H,10-13H2,1-3H3,(H,30,31);/q;+1/p-1/b9-8+;/t17-,18-;/m1./s1 |
| InChIKey | MLYNKTVDDQYWLE-SMUJUYJDSA-M |
| XLogP | -1.40 |
| TPSA | 130.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |