C24H28O6 — CID 142193194
3-[4-[3-(2-ethynyl-4-methylphenoxy)-2-hydroxypropoxy]phenyl]-2-propan-2-yloxypropanoic acid (PubChem CID 142193194) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is 3-[4-[3-(2-ethynyl-4-methylphenoxy)-2-hydroxypropoxy]phenyl]-2-propan-2-yloxypropanoic acid.
| Compound Name | 3-[4-[3-(2-ethynyl-4-methylphenoxy)-2-hydroxypropoxy]phenyl]-2-propan-2-yloxypropanoic acid |
|---|---|
| PubChem CID | 142193194 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 3-[4-[3-(2-ethynyl-4-methylphenoxy)-2-hydroxypropoxy]phenyl]-2-propan-2-yloxypropanoic acid |
| SMILES | C#Cc1cc(C)ccc1OCC(O)COc1ccc(CC(OC(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C24H28O6/c1-5-19-12-17(4)6-11-22(19)29-15-20(25)14-28-21-9-7-18(8-10-21)13-23(24(26)27)30-16(2)3/h1,6-12,16,20,23,25H,13-15H2,2-4H3,(H,26,27) |
| InChIKey | PLMXZYNAGQLJGN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|