C23H25ClO4 — CID 142193223
3-[3-[4-(4-chloro-2-methylphenyl)-2-hydroxybut-3-yn-2-yl]phenyl]-2-propan-2-yloxypropanoic acid (PubChem CID 142193223) has the molecular formula C23H25ClO4 and a molecular weight of 400.90 g/mol. Its IUPAC name is 3-[3-[4-(4-chloro-2-methylphenyl)-2-hydroxybut-3-yn-2-yl]phenyl]-2-propan-2-yloxypropanoic acid.
| Compound Name | 3-[3-[4-(4-chloro-2-methylphenyl)-2-hydroxybut-3-yn-2-yl]phenyl]-2-propan-2-yloxypropanoic acid |
|---|---|
| PubChem CID | 142193223 |
| Molecular Formula | C23H25ClO4 |
| Molecular Weight | 400.90 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3-[3-[4-(4-chloro-2-methylphenyl)-2-hydroxybut-3-yn-2-yl]phenyl]-2-propan-2-yloxypropanoic acid |
| SMILES | Cc1cc(Cl)ccc1C#CC(C)(O)c1cccc(CC(OC(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C23H25ClO4/c1-15(2)28-21(22(25)26)14-17-6-5-7-19(13-17)23(4,27)11-10-18-8-9-20(24)12-16(18)3/h5-9,12-13,15,21,27H,14H2,1-4H3,(H,25,26) |
| InChIKey | JCRPOHXPZICOGT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.90 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|