C20H23FNO5+ — CID 142193292
[4-(2-carboxy-2-propan-2-yloxyethyl)phenyl]methoxycarbonyl-(4-fluorophenyl)azanium (PubChem CID 142193292) has the molecular formula C20H23FNO5+ and a molecular weight of 376.40 g/mol. Its IUPAC name is [4-(2-carboxy-2-propan-2-yloxyethyl)phenyl]methoxycarbonyl-(4-fluorophenyl)azanium.
| Compound Name | [4-(2-carboxy-2-propan-2-yloxyethyl)phenyl]methoxycarbonyl-(4-fluorophenyl)azanium |
|---|---|
| PubChem CID | 142193292 |
| Molecular Formula | C20H23FNO5+ |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [4-(2-carboxy-2-propan-2-yloxyethyl)phenyl]methoxycarbonyl-(4-fluorophenyl)azanium |
| SMILES | CC(C)OC(Cc1ccc(COC(=O)[NH2+]c2ccc(F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C20H22FNO5/c1-13(2)27-18(19(23)24)11-14-3-5-15(6-4-14)12-26-20(25)22-17-9-7-16(21)8-10-17/h3-10,13,18H,11-12H2,1-2H3,(H,22,25)(H,23,24)/p+1 |
| InChIKey | HJYOOCJVEWKHHB-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|