C24H32NO8+ — CID 146815681
[5-(2-carboxy-2-propan-2-yloxyethyl)-2-ethoxyphenyl]methoxycarbonyl-(2,4-dimethoxyphenyl)azanium (PubChem CID 146815681) has the molecular formula C24H32NO8+ and a molecular weight of 462.52 g/mol. Its IUPAC name is [5-(2-carboxy-2-propan-2-yloxyethyl)-2-ethoxyphenyl]methoxycarbonyl-(2,4-dimethoxyphenyl)azanium.
| Compound Name | [5-(2-carboxy-2-propan-2-yloxyethyl)-2-ethoxyphenyl]methoxycarbonyl-(2,4-dimethoxyphenyl)azanium |
|---|---|
| PubChem CID | 146815681 |
| Molecular Formula | C24H32NO8+ |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | [5-(2-carboxy-2-propan-2-yloxyethyl)-2-ethoxyphenyl]methoxycarbonyl-(2,4-dimethoxyphenyl)azanium |
| SMILES | CCOc1ccc(CC(OC(C)C)C(=O)O)cc1COC(=O)[NH2+]c1ccc(OC)cc1OC |
| InChI | InChI=1S/C24H31NO8/c1-6-31-20-10-7-16(12-22(23(26)27)33-15(2)3)11-17(20)14-32-24(28)25-19-9-8-18(29-4)13-21(19)30-5/h7-11,13,15,22H,6,12,14H2,1-5H3,(H,25,28)(H,26,27)/p+1 |
| InChIKey | SBAOMHLMZSKQIN-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 117.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|