C30H29ClN2O5 — CID 142193726
3-[2-[[(2-chlorobenzoyl)amino]methyl]-4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]propanoic acid (PubChem CID 142193726) has the molecular formula C30H29ClN2O5 and a molecular weight of 533.02 g/mol. Its IUPAC name is 3-[2-[[(2-chlorobenzoyl)amino]methyl]-4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[[(2-chlorobenzoyl)amino]methyl]-4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 142193726 |
| Molecular Formula | C30H29ClN2O5 |
| Molecular Weight | 533.02 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 3-[2-[[(2-chlorobenzoyl)amino]methyl]-4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]propanoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1CCCOc1ccc(CCC(=O)O)c(CNC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C30H29ClN2O5/c1-20-27(33-30(38-20)22-8-3-2-4-9-22)12-7-17-37-24-15-13-21(14-16-28(34)35)23(18-24)19-32-29(36)25-10-5-6-11-26(25)31/h2-6,8-11,13,15,18H,7,12,14,16-17,19H2,1H3,(H,32,36)(H,34,35) |
| InChIKey | WDIGDMFSTHLCDL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.02 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|