C27H33N3O5 — CID 58979382
3-[2-[(butylcarbamoylamino)methyl]-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoic acid (PubChem CID 58979382) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is 3-[2-[(butylcarbamoylamino)methyl]-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[(butylcarbamoylamino)methyl]-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 58979382 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 3-[2-[(butylcarbamoylamino)methyl]-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoic acid |
| SMILES | CCCCNC(=O)NCc1cc(OCCc2nc(-c3ccccc3)oc2C)ccc1CCC(=O)O |
| InChI | InChI=1S/C27H33N3O5/c1-3-4-15-28-27(33)29-18-22-17-23(12-10-20(22)11-13-25(31)32)34-16-14-24-19(2)35-26(30-24)21-8-6-5-7-9-21/h5-10,12,17H,3-4,11,13-16,18H2,1-2H3,(H,31,32)(H2,28,29,33) |
| InChIKey | LGDLAYBXDDOMQF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|