C23H26BrN3O3S — CID 142195878
tert-butyl 4-[1-(benzenesulfinyl)-3-bromoindol-4-yl]piperazine-1-carboxylate (PubChem CID 142195878) has the molecular formula C23H26BrN3O3S and a molecular weight of 504.45 g/mol. Its IUPAC name is tert-butyl 4-[1-(benzenesulfinyl)-3-bromoindol-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(benzenesulfinyl)-3-bromoindol-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142195878 |
| Molecular Formula | C23H26BrN3O3S |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | tert-butyl 4-[1-(benzenesulfinyl)-3-bromoindol-4-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cccc3c2c(Br)cn3S(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26BrN3O3S/c1-23(2,3)30-22(28)26-14-12-25(13-15-26)19-10-7-11-20-21(19)18(24)16-27(20)31(29)17-8-5-4-6-9-17/h4-11,16H,12-15H2,1-3H3 |
| InChIKey | LQRIBNKCEXQKJE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |