C23H24BrN3O4 — CID 168517850
tert-butyl 4-[2-bromo-4-(1,3-dioxoisoindol-2-yl)phenyl]piperazine-1-carboxylate (PubChem CID 168517850) has the molecular formula C23H24BrN3O4 and a molecular weight of 486.37 g/mol. Its IUPAC name is tert-butyl 4-[2-bromo-4-(1,3-dioxoisoindol-2-yl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-bromo-4-(1,3-dioxoisoindol-2-yl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168517850 |
| Molecular Formula | C23H24BrN3O4 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | tert-butyl 4-[2-bromo-4-(1,3-dioxoisoindol-2-yl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(N3C(=O)c4ccccc4C3=O)cc2Br)CC1 |
| InChI | InChI=1S/C23H24BrN3O4/c1-23(2,3)31-22(30)26-12-10-25(11-13-26)19-9-8-15(14-18(19)24)27-20(28)16-6-4-5-7-17(16)21(27)29/h4-9,14H,10-13H2,1-3H3 |
| InChIKey | ZEXHZJIPZWFMET-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|