C17H30N4OS — CID 142196213
4-N-(5-butylsulfanylpent-1-en-2-yl)-1-N-methylbenzene-1,4-diamine;formohydrazide (PubChem CID 142196213) has the molecular formula C17H30N4OS and a molecular weight of 338.52 g/mol. Its IUPAC name is 4-N-(5-butylsulfanylpent-1-en-2-yl)-1-N-methylbenzene-1,4-diamine;formohydrazide.
| Compound Name | 4-N-(5-butylsulfanylpent-1-en-2-yl)-1-N-methylbenzene-1,4-diamine;formohydrazide |
|---|---|
| PubChem CID | 142196213 |
| Molecular Formula | C17H30N4OS |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 4-N-(5-butylsulfanylpent-1-en-2-yl)-1-N-methylbenzene-1,4-diamine;formohydrazide |
| SMILES | C=C(CCCSCCCC)Nc1ccc(NC)cc1.NNC=O |
| InChI | InChI=1S/C16H26N2S.CH4N2O/c1-4-5-12-19-13-6-7-14(2)18-16-10-8-15(17-3)9-11-16;2-3-1-4/h8-11,17-18H,2,4-7,12-13H2,1,3H3;1H,2H2,(H,3,4) |
| InChIKey | PEAJSPFVWRLJET-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|