C27H31N3O5S2 — CID 142196519
2-[4-[3-(benzenesulfonamido)-2-oxopiperidin-1-yl]phenyl]-N-tert-butylbenzenesulfonamide (PubChem CID 142196519) has the molecular formula C27H31N3O5S2 and a molecular weight of 541.70 g/mol. Its IUPAC name is 2-[4-[3-(benzenesulfonamido)-2-oxopiperidin-1-yl]phenyl]-N-tert-butylbenzenesulfonamide.
| Compound Name | 2-[4-[3-(benzenesulfonamido)-2-oxopiperidin-1-yl]phenyl]-N-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 142196519 |
| Molecular Formula | C27H31N3O5S2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 2-[4-[3-(benzenesulfonamido)-2-oxopiperidin-1-yl]phenyl]-N-tert-butylbenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1-c1ccc(N2CCCC(NS(=O)(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H31N3O5S2/c1-27(2,3)29-37(34,35)25-14-8-7-12-23(25)20-15-17-21(18-16-20)30-19-9-13-24(26(30)31)28-36(32,33)22-10-5-4-6-11-22/h4-8,10-12,14-18,24,28-29H,9,13,19H2,1-3H3 |
| InChIKey | UBBMAUXCGULMGS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |