C25H29N3O3 — CID 142197351
N-(3-ethoxypropyl)-2-[5-methoxy-3-(7-methyl-1H-indol-2-yl)indol-1-yl]acetamide (PubChem CID 142197351) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[5-methoxy-3-(7-methyl-1H-indol-2-yl)indol-1-yl]acetamide.
| Compound Name | N-(3-ethoxypropyl)-2-[5-methoxy-3-(7-methyl-1H-indol-2-yl)indol-1-yl]acetamide |
|---|---|
| PubChem CID | 142197351 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[5-methoxy-3-(7-methyl-1H-indol-2-yl)indol-1-yl]acetamide |
| SMILES | CCOCCCNC(=O)Cn1cc(-c2cc3cccc(C)c3[nH]2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C25H29N3O3/c1-4-31-12-6-11-26-24(29)16-28-15-21(20-14-19(30-3)9-10-23(20)28)22-13-18-8-5-7-17(2)25(18)27-22/h5,7-10,13-15,27H,4,6,11-12,16H2,1-3H3,(H,26,29) |
| InChIKey | XLQNAQCYFJHZOA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|