C20H19N5O3 — CID 123914703
2-[5-methoxy-3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),5,7,11-tetraen-11-yl)indol-1-yl]acetic acid (PubChem CID 123914703) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-[5-methoxy-3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),5,7,11-tetraen-11-yl)indol-1-yl]acetic acid.
| Compound Name | 2-[5-methoxy-3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),5,7,11-tetraen-11-yl)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 123914703 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-[5-methoxy-3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),5,7,11-tetraen-11-yl)indol-1-yl]acetic acid |
| SMILES | COc1ccc2c(c1)c(-c1cc3c([nH]1)N=CC1=CNN(C)C13)cn2CC(=O)O |
| InChI | InChI=1S/C20H19N5O3/c1-24-19-11(8-22-24)7-21-20-14(19)6-16(23-20)15-9-25(10-18(26)27)17-4-3-12(28-2)5-13(15)17/h3-9,19,22-23H,10H2,1-2H3,(H,26,27) |
| InChIKey | XLNZPDXEEWLCSX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |