C21H23N5O — CID 123144372
11-(5-methoxy-1-propan-2-ylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),5,7,11-tetraene (PubChem CID 123144372) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 11-(5-methoxy-1-propan-2-ylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),5,7,11-tetraene.
| Compound Name | 11-(5-methoxy-1-propan-2-ylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),5,7,11-tetraene |
|---|---|
| PubChem CID | 123144372 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 11-(5-methoxy-1-propan-2-ylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),5,7,11-tetraene |
| SMILES | COc1ccc2c(c1)c(-c1cc3c([nH]1)N=CC1=CNN(C)C13)cn2C(C)C |
| InChI | InChI=1S/C21H23N5O/c1-12(2)26-11-17(15-7-14(27-4)5-6-19(15)26)18-8-16-20-13(10-23-25(20)3)9-22-21(16)24-18/h5-12,20,23-24H,1-4H3 |
| InChIKey | MBGJPPURIRHATC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |