C10H14N2 — CID 142199124
2-ethyl-3-methyl-1,8a-dihydroimidazo[1,2-a]pyridine (PubChem CID 142199124) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-ethyl-3-methyl-1,8a-dihydroimidazo[1,2-a]pyridine.
| Compound Name | 2-ethyl-3-methyl-1,8a-dihydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 142199124 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-ethyl-3-methyl-1,8a-dihydroimidazo[1,2-a]pyridine |
| SMILES | CCC1=C(C)N2C=CC=CC2N1 |
| InChI | InChI=1S/C10H14N2/c1-3-9-8(2)12-7-5-4-6-10(12)11-9/h4-7,10-11H,3H2,1-2H3 |
| InChIKey | CFPXJCRNZMLXKW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |