C12H23FN2 — CID 174319375
N'-ethyl-N-[(3Z)-1-fluorohexa-3,5-dien-3-yl]-N'-propylmethanediamine (PubChem CID 174319375) has the molecular formula C12H23FN2 and a molecular weight of 214.33 g/mol. Its IUPAC name is N'-ethyl-N-[(3Z)-1-fluorohexa-3,5-dien-3-yl]-N'-propylmethanediamine.
| Compound Name | N'-ethyl-N-[(3Z)-1-fluorohexa-3,5-dien-3-yl]-N'-propylmethanediamine |
|---|---|
| PubChem CID | 174319375 |
| Molecular Formula | C12H23FN2 |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | N'-ethyl-N-[(3Z)-1-fluorohexa-3,5-dien-3-yl]-N'-propylmethanediamine |
| SMILES | C=C/C=C(/CCF)NCN(CC)CCC |
| InChI | InChI=1S/C12H23FN2/c1-4-7-12(8-9-13)14-11-15(6-3)10-5-2/h4,7,14H,1,5-6,8-11H2,2-3H3/b12-7- |
| InChIKey | NSWZMOFTWHENOC-GHXNOFRVSA-N |
| XLogP | 2.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|