C17H21FN2 — CID 130349826
6-(3-ethenyl-5-fluorocyclohepta-1,4,6-trien-1-yl)-N,1,5-trimethyl-2H-pyridin-2-amine (PubChem CID 130349826) has the molecular formula C17H21FN2 and a molecular weight of 272.37 g/mol. Its IUPAC name is 6-(3-ethenyl-5-fluorocyclohepta-1,4,6-trien-1-yl)-N,1,5-trimethyl-2H-pyridin-2-amine.
| Compound Name | 6-(3-ethenyl-5-fluorocyclohepta-1,4,6-trien-1-yl)-N,1,5-trimethyl-2H-pyridin-2-amine |
|---|---|
| PubChem CID | 130349826 |
| Molecular Formula | C17H21FN2 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 6-(3-ethenyl-5-fluorocyclohepta-1,4,6-trien-1-yl)-N,1,5-trimethyl-2H-pyridin-2-amine |
| SMILES | C=CC1C=C(F)C=CC(C2=C(C)C=CC(NC)N2C)=C1 |
| InChI | InChI=1S/C17H21FN2/c1-5-13-10-14(7-8-15(18)11-13)17-12(2)6-9-16(19-3)20(17)4/h5-11,13,16,19H,1H2,2-4H3 |
| InChIKey | KEVUOUSRCWIBDI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|