C24H33FN2 — CID 138663310
(2Z)-2-ethylidene-4-(2-fluoro-6-methylcyclohexa-2,4-dien-1-yl)-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-(2-methylpropyl)-1,6-dihydropyrimidine (PubChem CID 138663310) has the molecular formula C24H33FN2 and a molecular weight of 368.54 g/mol. Its IUPAC name is (2Z)-2-ethylidene-4-(2-fluoro-6-methylcyclohexa-2,4-dien-1-yl)-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-(2-methylpropyl)-1,6-dihydropyrimidine.
| Compound Name | (2Z)-2-ethylidene-4-(2-fluoro-6-methylcyclohexa-2,4-dien-1-yl)-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-(2-methylpropyl)-1,6-dihydropyrimidine |
|---|---|
| PubChem CID | 138663310 |
| Molecular Formula | C24H33FN2 |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | (2Z)-2-ethylidene-4-(2-fluoro-6-methylcyclohexa-2,4-dien-1-yl)-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-(2-methylpropyl)-1,6-dihydropyrimidine |
| SMILES | C=C/C=C(\C=C/C)C1=C(C2C(F)=CC=CC2C)N(CC(C)C)/C(=C\C)NC1 |
| InChI | InChI=1S/C24H33FN2/c1-7-11-19(12-8-2)20-15-26-22(9-3)27(16-17(4)5)24(20)23-18(6)13-10-14-21(23)25/h7-14,17-18,23,26H,1,15-16H2,2-6H3/b12-8-,19-11+,22-9- |
| InChIKey | KFWCDMRZIIDEIK-WFPQYHSBSA-N |
| XLogP | 6.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|