C27H40N2 — CID 90274149
(3Z)-1-N'-[(4E,6E,8E,9Z)-8-ethylidene-2-methyl-3-methylidene-5-propan-2-yldodeca-4,6,9,11-tetraen-4-yl]-1-N-methyl-2-methylidenehexa-3,5-diene-1,1-diamine (PubChem CID 90274149) has the molecular formula C27H40N2 and a molecular weight of 392.63 g/mol. Its IUPAC name is (3Z)-1-N'-[(4E,6E,8E,9Z)-8-ethylidene-2-methyl-3-methylidene-5-propan-2-yldodeca-4,6,9,11-tetraen-4-yl]-1-N-methyl-2-methylidenehexa-3,5-diene-1,1-diamine.
| Compound Name | (3Z)-1-N'-[(4E,6E,8E,9Z)-8-ethylidene-2-methyl-3-methylidene-5-propan-2-yldodeca-4,6,9,11-tetraen-4-yl]-1-N-methyl-2-methylidenehexa-3,5-diene-1,1-diamine |
|---|---|
| PubChem CID | 90274149 |
| Molecular Formula | C27H40N2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | (3Z)-1-N'-[(4E,6E,8E,9Z)-8-ethylidene-2-methyl-3-methylidene-5-propan-2-yldodeca-4,6,9,11-tetraen-4-yl]-1-N-methyl-2-methylidenehexa-3,5-diene-1,1-diamine |
| SMILES | C=C/C=C\C(=C)C(NC)N/C(C(=C)C(C)C)=C(/C=C/C(/C=C\C=C)=C/C)C(C)C |
| InChI | InChI=1S/C27H40N2/c1-11-14-16-22(8)27(28-10)29-26(23(9)20(4)5)25(21(6)7)19-18-24(13-3)17-15-12-2/h11-21,27-29H,1-2,8-9H2,3-7,10H3/b16-14-,17-15-,19-18+,24-13+,26-25- |
| InChIKey | HMMOIGTTYLYXII-QHONWSCKSA-N |
| XLogP | 6.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|