C16H32N2 — CID 138495117
1-N-(2-methylbutyl)-1-N'-[(E)-3-methylhept-3-en-2-yl]prop-2-ene-1,1-diamine (PubChem CID 138495117) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 1-N-(2-methylbutyl)-1-N'-[(E)-3-methylhept-3-en-2-yl]prop-2-ene-1,1-diamine.
| Compound Name | 1-N-(2-methylbutyl)-1-N'-[(E)-3-methylhept-3-en-2-yl]prop-2-ene-1,1-diamine |
|---|---|
| PubChem CID | 138495117 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 1-N-(2-methylbutyl)-1-N'-[(E)-3-methylhept-3-en-2-yl]prop-2-ene-1,1-diamine |
| SMILES | C=CC(NCC(C)CC)NC(C)/C(C)=C/CCC |
| InChI | InChI=1S/C16H32N2/c1-7-10-11-14(5)15(6)18-16(9-3)17-12-13(4)8-2/h9,11,13,15-18H,3,7-8,10,12H2,1-2,4-6H3/b14-11+ |
| InChIKey | RENXURWEBYDQEH-SDNWHVSQSA-N |
| XLogP | 3.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|