C10H18N2 — CID 123269053
N,4,8-trimethyl-1,2,5,8-tetrahydroazocin-2-amine (PubChem CID 123269053) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N,4,8-trimethyl-1,2,5,8-tetrahydroazocin-2-amine.
| Compound Name | N,4,8-trimethyl-1,2,5,8-tetrahydroazocin-2-amine |
|---|---|
| PubChem CID | 123269053 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N,4,8-trimethyl-1,2,5,8-tetrahydroazocin-2-amine |
| SMILES | CNC1C=C(C)CC=CC(C)N1 |
| InChI | InChI=1S/C10H18N2/c1-8-5-4-6-9(2)12-10(7-8)11-3/h4,6-7,9-12H,5H2,1-3H3 |
| InChIKey | VVSBIFVQUBJJJY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|