C12H27N3 — CID 88939552
N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine (PubChem CID 88939552) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine.
| Compound Name | N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine |
|---|---|
| PubChem CID | 88939552 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine |
| SMILES | CCC(/C=C\C(C)C(C)C)NCNCN |
| InChI | InChI=1S/C12H27N3/c1-5-12(15-9-14-8-13)7-6-11(4)10(2)3/h6-7,10-12,14-15H,5,8-9,13H2,1-4H3/b7-6- |
| InChIKey | GKAFUABZWFHTET-SREVYHEPSA-N |
| XLogP | 1.67 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|