About N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine
N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine (PubChem CID 88939552) has the molecular formula C12H27N3
and a molecular weight of 213.37 g/mol. Its IUPAC name is N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine.
Molecular Properties
| Compound Name | N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine |
| PubChem CID | 88939552 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine |
| SMILES | CCC(/C=C\C(C)C(C)C)NCNCN |
| InChI | InChI=1S/C12H27N3/c1-5-12(15-9-14-8-13)7-6-11(4)10(2)3/h6-7,10-12,14-15H,5,8-9,13H2,1-4H3/b7-6- |
| InChIKey | GKAFUABZWFHTET-SREVYHEPSA-N |
| XLogP | 1.67 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine?
The IUPAC name of N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine (CID 88939552) is N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine.
What is the SMILES notation for N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine?
The canonical SMILES for N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine is CCC(/C=C\C(C)C(C)C)NCNCN.
What is the InChIKey of N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine?
The InChIKey is GKAFUABZWFHTET-SREVYHEPSA-N. The full InChI is InChI=1S/C12H27N3/c1-5-12(15-9-14-8-13)7-6-11(4)10(2)3/h6-7,10-12,14-15H,5,8-9,13H2,1-4H3/b7-6-.
What are the key properties of N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine?
N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine has a molecular weight of 213.37 g/mol, XLogP of 1.67, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[[(Z)-6,7-dimethyloct-4-en-3-yl]amino]methyl]methanediamine is sourced from PubChem (CID 88939552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).