C17H32N2 — CID 123573653
N'-but-3-en-2-yl-N-(2-but-2-enyl-3-ethylhex-4-enyl)methanediamine (PubChem CID 123573653) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is N'-but-3-en-2-yl-N-(2-but-2-enyl-3-ethylhex-4-enyl)methanediamine.
| Compound Name | N'-but-3-en-2-yl-N-(2-but-2-enyl-3-ethylhex-4-enyl)methanediamine |
|---|---|
| PubChem CID | 123573653 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | N'-but-3-en-2-yl-N-(2-but-2-enyl-3-ethylhex-4-enyl)methanediamine |
| SMILES | C=CC(C)NCNCC(CC=CC)C(C=CC)CC |
| InChI | InChI=1S/C17H32N2/c1-6-10-12-17(16(9-4)11-7-2)13-18-14-19-15(5)8-3/h6-8,10-11,15-19H,3,9,12-14H2,1-2,4-5H3 |
| InChIKey | PBXSRSGEOHCXRJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|