C27H55N3 — CID 123187557
12-N,17-N-diethyl-17,18,19-trimethylicosa-7,14-diene-3,12,17-triamine (PubChem CID 123187557) has the molecular formula C27H55N3 and a molecular weight of 421.76 g/mol. Its IUPAC name is 12-N,17-N-diethyl-17,18,19-trimethylicosa-7,14-diene-3,12,17-triamine.
| Compound Name | 12-N,17-N-diethyl-17,18,19-trimethylicosa-7,14-diene-3,12,17-triamine |
|---|---|
| PubChem CID | 123187557 |
| Molecular Formula | C27H55N3 |
| Molecular Weight | 421.76 g/mol |
| Exact Mass | 421.44 |
| IUPAC Name | 12-N,17-N-diethyl-17,18,19-trimethylicosa-7,14-diene-3,12,17-triamine |
| SMILES | CCNC(CC=CCC(C)(NCC)C(C)C(C)C)CCCC=CCCCC(N)CC |
| InChI | InChI=1S/C27H55N3/c1-8-25(28)19-15-13-11-12-14-16-20-26(29-9-2)21-17-18-22-27(7,30-10-3)24(6)23(4)5/h11-12,17-18,23-26,29-30H,8-10,13-16,19-22,28H2,1-7H3 |
| InChIKey | IYSKUQWJLZQVFT-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.76 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|