C28H47N3 — CID 91169767
N"-[5-ethylidene-6-methyl-11-(3,3,4-trimethylcycloocta-1,5,7-trien-1-yl)dodeca-6,8-dien-2-yl]-N'-methylmethanetriamine (PubChem CID 91169767) has the molecular formula C28H47N3 and a molecular weight of 425.71 g/mol. Its IUPAC name is N"-[5-ethylidene-6-methyl-11-(3,3,4-trimethylcycloocta-1,5,7-trien-1-yl)dodeca-6,8-dien-2-yl]-N'-methylmethanetriamine.
| Compound Name | N"-[5-ethylidene-6-methyl-11-(3,3,4-trimethylcycloocta-1,5,7-trien-1-yl)dodeca-6,8-dien-2-yl]-N'-methylmethanetriamine |
|---|---|
| PubChem CID | 91169767 |
| Molecular Formula | C28H47N3 |
| Molecular Weight | 425.71 g/mol |
| Exact Mass | 425.38 |
| IUPAC Name | N"-[5-ethylidene-6-methyl-11-(3,3,4-trimethylcycloocta-1,5,7-trien-1-yl)dodeca-6,8-dien-2-yl]-N'-methylmethanetriamine |
| SMILES | CC=C(CCC(C)NC(N)NC)C(C)=CC=CCC(C)C1=CC(C)(C)C(C)C=CC=C1 |
| InChI | InChI=1S/C28H47N3/c1-9-25(19-18-24(5)31-27(29)30-8)21(2)14-10-11-15-22(3)26-17-13-12-16-23(4)28(6,7)20-26/h9-14,16-17,20,22-24,27,30-31H,15,18-19,29H2,1-8H3 |
| InChIKey | WJRNBISIYPXALX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|