C24H38N2 — CID 143352157
1-N-[1-[(2Z,5Z)-9-bicyclo[5.3.1]undeca-1(11),2,5-trienyl]ethyl]-1-N'-(2,6-dimethylhept-6-en-3-yl)ethene-1,1-diamine (PubChem CID 143352157) has the molecular formula C24H38N2 and a molecular weight of 354.58 g/mol. Its IUPAC name is 1-N-[1-[(2Z,5Z)-9-bicyclo[5.3.1]undeca-1(11),2,5-trienyl]ethyl]-1-N'-(2,6-dimethylhept-6-en-3-yl)ethene-1,1-diamine.
| Compound Name | 1-N-[1-[(2Z,5Z)-9-bicyclo[5.3.1]undeca-1(11),2,5-trienyl]ethyl]-1-N'-(2,6-dimethylhept-6-en-3-yl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 143352157 |
| Molecular Formula | C24H38N2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | 1-N-[1-[(2Z,5Z)-9-bicyclo[5.3.1]undeca-1(11),2,5-trienyl]ethyl]-1-N'-(2,6-dimethylhept-6-en-3-yl)ethene-1,1-diamine |
| SMILES | C=C(C)CCC(NC(=C)NC(C)C1CC2=CC(/C=C\C/C=C\2)C1)C(C)C |
| InChI | InChI=1S/C24H38N2/c1-17(2)12-13-24(18(3)4)26-20(6)25-19(5)23-15-21-10-8-7-9-11-22(14-21)16-23/h8-11,14,18-19,21,23-26H,1,6-7,12-13,15-16H2,2-5H3/b10-8-,11-9- |
| InChIKey | LIDIEVJZBFBOIU-WGEIWTTOSA-N |
| XLogP | 5.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|