C19H33FN2 — CID 154665788
1-N-[(Z,5Z)-5-ethylideneoct-6-enyl]-1-N'-(4-fluoro-4-methylcyclohexyl)ethene-1,1-diamine (PubChem CID 154665788) has the molecular formula C19H33FN2 and a molecular weight of 308.48 g/mol. Its IUPAC name is 1-N-[(Z,5Z)-5-ethylideneoct-6-enyl]-1-N'-(4-fluoro-4-methylcyclohexyl)ethene-1,1-diamine.
| Compound Name | 1-N-[(Z,5Z)-5-ethylideneoct-6-enyl]-1-N'-(4-fluoro-4-methylcyclohexyl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 154665788 |
| Molecular Formula | C19H33FN2 |
| Molecular Weight | 308.48 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | 1-N-[(Z,5Z)-5-ethylideneoct-6-enyl]-1-N'-(4-fluoro-4-methylcyclohexyl)ethene-1,1-diamine |
| SMILES | C=C(NCCCCC(/C=C\C)=C/C)NC1CCC(C)(F)CC1 |
| InChI | InChI=1S/C19H33FN2/c1-5-9-17(6-2)10-7-8-15-21-16(3)22-18-11-13-19(4,20)14-12-18/h5-6,9,18,21-22H,3,7-8,10-15H2,1-2,4H3/b9-5-,17-6+ |
| InChIKey | HJMCTRMDPAPXMG-JKECTIFDSA-N |
| XLogP | 5.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|