C18H35N3 — CID 146292359
(E)-1-N,5,5-trimethyl-6-N-(methylaminomethyl)-2-[(2Z)-penta-2,4-dienyl]oct-1-ene-1,6-diamine (PubChem CID 146292359) has the molecular formula C18H35N3 and a molecular weight of 293.50 g/mol. Its IUPAC name is (E)-1-N,5,5-trimethyl-6-N-(methylaminomethyl)-2-[(2Z)-penta-2,4-dienyl]oct-1-ene-1,6-diamine.
| Compound Name | (E)-1-N,5,5-trimethyl-6-N-(methylaminomethyl)-2-[(2Z)-penta-2,4-dienyl]oct-1-ene-1,6-diamine |
|---|---|
| PubChem CID | 146292359 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | (E)-1-N,5,5-trimethyl-6-N-(methylaminomethyl)-2-[(2Z)-penta-2,4-dienyl]oct-1-ene-1,6-diamine |
| SMILES | C=C/C=C\C/C(=C/NC)CCC(C)(C)C(CC)NCNC |
| InChI | InChI=1S/C18H35N3/c1-7-9-10-11-16(14-19-5)12-13-18(3,4)17(8-2)21-15-20-6/h7,9-10,14,17,19-21H,1,8,11-13,15H2,2-6H3/b10-9-,16-14- |
| InChIKey | IIXLFVINXIMMMD-PZIJCTOESA-N |
| XLogP | 3.57 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|