C27H50N2 — CID 91389775
5-tert-butyl-N,2-dimethyl-4-methylidene-N-(2,2,6,6,7-pentamethyloct-7-en-4-yl)-2,3,5,8-tetrahydro-1H-azocin-8-amine (PubChem CID 91389775) has the molecular formula C27H50N2 and a molecular weight of 402.71 g/mol. Its IUPAC name is 5-tert-butyl-N,2-dimethyl-4-methylidene-N-(2,2,6,6,7-pentamethyloct-7-en-4-yl)-2,3,5,8-tetrahydro-1H-azocin-8-amine.
| Compound Name | 5-tert-butyl-N,2-dimethyl-4-methylidene-N-(2,2,6,6,7-pentamethyloct-7-en-4-yl)-2,3,5,8-tetrahydro-1H-azocin-8-amine |
|---|---|
| PubChem CID | 91389775 |
| Molecular Formula | C27H50N2 |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 402.40 |
| IUPAC Name | 5-tert-butyl-N,2-dimethyl-4-methylidene-N-(2,2,6,6,7-pentamethyloct-7-en-4-yl)-2,3,5,8-tetrahydro-1H-azocin-8-amine |
| SMILES | C=C1CC(C)NC(N(C)C(CC(C)(C)C)CC(C)(C)C(=C)C)C=CC1C(C)(C)C |
| InChI | InChI=1S/C27H50N2/c1-19(2)27(11,12)18-22(17-25(5,6)7)29(13)24-15-14-23(26(8,9)10)20(3)16-21(4)28-24/h14-15,21-24,28H,1,3,16-18H2,2,4-13H3 |
| InChIKey | QMVYDPOVJXCIOV-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|