C21H39N — CID 91561481
4-tert-butyl-2-(7-tert-butylcycloocten-1-yl)piperidine (PubChem CID 91561481) has the molecular formula C21H39N and a molecular weight of 305.55 g/mol. Its IUPAC name is 4-tert-butyl-2-(7-tert-butylcycloocten-1-yl)piperidine.
| Compound Name | 4-tert-butyl-2-(7-tert-butylcycloocten-1-yl)piperidine |
|---|---|
| PubChem CID | 91561481 |
| Molecular Formula | C21H39N |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 305.31 |
| IUPAC Name | 4-tert-butyl-2-(7-tert-butylcycloocten-1-yl)piperidine |
| SMILES | CC(C)(C)C1CCCCC=C(C2CC(C(C)(C)C)CCN2)C1 |
| InChI | InChI=1S/C21H39N/c1-20(2,3)17-11-9-7-8-10-16(14-17)19-15-18(12-13-22-19)21(4,5)6/h10,17-19,22H,7-9,11-15H2,1-6H3 |
| InChIKey | ROJYWKQJWWEDCU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|