C25H52N2 — CID 130216944
1-N'-[3-[(Z,3R)-3-ethylhept-1-enyl]-2,5-dimethyldodecyl]ethane-1,1-diamine (PubChem CID 130216944) has the molecular formula C25H52N2 and a molecular weight of 380.71 g/mol. Its IUPAC name is 1-N'-[3-[(Z,3R)-3-ethylhept-1-enyl]-2,5-dimethyldodecyl]ethane-1,1-diamine.
| Compound Name | 1-N'-[3-[(Z,3R)-3-ethylhept-1-enyl]-2,5-dimethyldodecyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 130216944 |
| Molecular Formula | C25H52N2 |
| Molecular Weight | 380.71 g/mol |
| Exact Mass | 380.41 |
| IUPAC Name | 1-N'-[3-[(Z,3R)-3-ethylhept-1-enyl]-2,5-dimethyldodecyl]ethane-1,1-diamine |
| SMILES | CCCCCCCC(C)CC(/C=C\[C@H](CC)CCCC)C(C)CNC(C)N |
| InChI | InChI=1S/C25H52N2/c1-7-10-12-13-14-15-21(4)19-25(22(5)20-27-23(6)26)18-17-24(9-3)16-11-8-2/h17-18,21-25,27H,7-16,19-20,26H2,1-6H3/b18-17-/t21?,22?,23?,24-,25?/m1/s1 |
| InChIKey | ITVURAIYJNMFOM-RKMQDURJSA-N |
| XLogP | 7.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.71 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|