C17H36N2 — CID 54472086
butane;1-N'-[2-[(1S,4R)-4,5-dimethylcyclopent-2-en-1-yl]propan-2-yl]-1-N-methylethane-1,1-diamine (PubChem CID 54472086) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is butane;1-N'-[2-[(1S,4R)-4,5-dimethylcyclopent-2-en-1-yl]propan-2-yl]-1-N-methylethane-1,1-diamine.
| Compound Name | butane;1-N'-[2-[(1S,4R)-4,5-dimethylcyclopent-2-en-1-yl]propan-2-yl]-1-N-methylethane-1,1-diamine |
|---|---|
| PubChem CID | 54472086 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | butane;1-N'-[2-[(1S,4R)-4,5-dimethylcyclopent-2-en-1-yl]propan-2-yl]-1-N-methylethane-1,1-diamine |
| SMILES | CCCC.CNC(C)NC(C)(C)[C@H]1C=C[C@@H](C)C1C |
| InChI | InChI=1S/C13H26N2.C4H10/c1-9-7-8-12(10(9)2)13(4,5)15-11(3)14-6;1-3-4-2/h7-12,14-15H,1-6H3;3-4H2,1-2H3/t9-,10?,11?,12+;/m1./s1 |
| InChIKey | XJBCVSFEESSZIA-NVHVCUPZSA-N |
| XLogP | 4.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|