C17H29FN2 — CID 143831275
1-N-[(Z)-7-fluoronon-6-enyl]-1-N'-(1-methylcyclopent-3-en-1-yl)ethene-1,1-diamine (PubChem CID 143831275) has the molecular formula C17H29FN2 and a molecular weight of 280.43 g/mol. Its IUPAC name is 1-N-[(Z)-7-fluoronon-6-enyl]-1-N'-(1-methylcyclopent-3-en-1-yl)ethene-1,1-diamine.
| Compound Name | 1-N-[(Z)-7-fluoronon-6-enyl]-1-N'-(1-methylcyclopent-3-en-1-yl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 143831275 |
| Molecular Formula | C17H29FN2 |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 1-N-[(Z)-7-fluoronon-6-enyl]-1-N'-(1-methylcyclopent-3-en-1-yl)ethene-1,1-diamine |
| SMILES | C=C(NCCCCC/C=C(\F)CC)NC1(C)CC=CC1 |
| InChI | InChI=1S/C17H29FN2/c1-4-16(18)11-7-5-6-10-14-19-15(2)20-17(3)12-8-9-13-17/h8-9,11,19-20H,2,4-7,10,12-14H2,1,3H3/b16-11- |
| InChIKey | AYQHCZWHMBVEKH-WJDWOHSUSA-N |
| XLogP | 4.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|