About ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine
ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine (PubChem CID 143831239) has the molecular formula C19H37FN2
and a molecular weight of 312.52 g/mol. Its IUPAC name is ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine.
Molecular Properties
| Compound Name | ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine |
| PubChem CID | 143831239 |
| Molecular Formula | C19H37FN2 |
| Molecular Weight | 312.52 g/mol |
| Exact Mass | 312.29 |
| IUPAC Name | ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine |
| SMILES | C=C.CCCC(F)CCCCCCNCNC1(C)CC=CC1 |
| InChI | InChI=1S/C17H33FN2.C2H4/c1-3-10-16(18)11-6-4-5-9-14-19-15-20-17(2)12-7-8-13-17;1-2/h7-8,16,19-20H,3-6,9-15H2,1-2H3;1-2H2 |
| InChIKey | JCKLCGOTCDYNBQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine?
The IUPAC name of ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine (CID 143831239) is ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine.
What is the SMILES notation for ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine?
The canonical SMILES for ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine is C=C.CCCC(F)CCCCCCNCNC1(C)CC=CC1.
What is the InChIKey of ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine?
The InChIKey is JCKLCGOTCDYNBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33FN2.C2H4/c1-3-10-16(18)11-6-4-5-9-14-19-15-20-17(2)12-7-8-13-17;1-2/h7-8,16,19-20H,3-6,9-15H2,1-2H3;1-2H2.
What are the key properties of ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine?
ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine has a molecular weight of 312.52 g/mol, XLogP of 5.12, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;N-(7-fluorodecyl)-N'-(1-methylcyclopent-3-en-1-yl)methanediamine is sourced from PubChem (CID 143831239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).