C15H30Cl2N2Zr — CID 20647672
carbanide;1-N'-(2-cyclopent-3-en-1-ylpropan-2-yl)-1-N,2,2-trimethylpropane-1,1-diamine;dichlorozirconium(2+) (PubChem CID 20647672) has the molecular formula C15H30Cl2N2Zr and a molecular weight of 400.55 g/mol. Its IUPAC name is carbanide;1-N'-(2-cyclopent-3-en-1-ylpropan-2-yl)-1-N,2,2-trimethylpropane-1,1-diamine;dichlorozirconium(2+).
| Compound Name | carbanide;1-N'-(2-cyclopent-3-en-1-ylpropan-2-yl)-1-N,2,2-trimethylpropane-1,1-diamine;dichlorozirconium(2+) |
|---|---|
| PubChem CID | 20647672 |
| Molecular Formula | C15H30Cl2N2Zr |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | carbanide;1-N'-(2-cyclopent-3-en-1-ylpropan-2-yl)-1-N,2,2-trimethylpropane-1,1-diamine;dichlorozirconium(2+) |
| SMILES | CNC(NC(C)(C)[C-]1CC=CC1)C(C)(C)C.Cl[Zr+2]Cl.[CH3-] |
| InChI | InChI=1S/C14H27N2.CH3.2ClH.Zr/c1-13(2,3)12(15-6)16-14(4,5)11-9-7-8-10-11;;;;/h7-8,12,15-16H,9-10H2,1-6H3;1H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | XAKNMGFBIISXFR-UHFFFAOYSA-L |
| XLogP | 4.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|