C41H78N2 — CID 58069474
N'-methyl-N'-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]ethane-1,2-diamine (PubChem CID 58069474) has the molecular formula C41H78N2 and a molecular weight of 599.09 g/mol. Its IUPAC name is N'-methyl-N'-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 58069474 |
| Molecular Formula | C41H78N2 |
| Molecular Weight | 599.09 g/mol |
| Exact Mass | 598.62 |
| IUPAC Name | N'-methyl-N'-[(11Z,14Z)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl]ethane-1,2-diamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)CN(C)CCN |
| InChI | InChI=1S/C41H78N2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41(40-43(3)39-38-42)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,41H,4-11,16-17,22-40,42H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | XBCQKSHVMUNLCU-QYCRHRGJSA-N |
| XLogP | 12.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.09 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|