C21H40N2 — CID 163104976
N,N'-dimethyl-N'-(14-methylhexadec-12-en-10-ynyl)ethane-1,2-diamine (PubChem CID 163104976) has the molecular formula C21H40N2 and a molecular weight of 320.56 g/mol. Its IUPAC name is N,N'-dimethyl-N'-(14-methylhexadec-12-en-10-ynyl)ethane-1,2-diamine.
| Compound Name | N,N'-dimethyl-N'-(14-methylhexadec-12-en-10-ynyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 163104976 |
| Molecular Formula | C21H40N2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.32 |
| IUPAC Name | N,N'-dimethyl-N'-(14-methylhexadec-12-en-10-ynyl)ethane-1,2-diamine |
| SMILES | CCC(C)C=CC#CCCCCCCCCCN(C)CCNC |
| InChI | InChI=1S/C21H40N2/c1-5-21(2)17-15-13-11-9-7-6-8-10-12-14-16-19-23(4)20-18-22-3/h15,17,21-22H,5-10,12,14,16,18-20H2,1-4H3 |
| InChIKey | LWKDZEJEHVOOAP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|