C22H40N2 — CID 163107415
N'-heptadeca-12,16-dien-10-ynyl-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 163107415) has the molecular formula C22H40N2 and a molecular weight of 332.58 g/mol. Its IUPAC name is N'-heptadeca-12,16-dien-10-ynyl-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-heptadeca-12,16-dien-10-ynyl-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 163107415 |
| Molecular Formula | C22H40N2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | N'-heptadeca-12,16-dien-10-ynyl-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | C=CCCC=CC#CCCCCCCCCCN(C)CCN(C)C |
| InChI | InChI=1S/C22H40N2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(4)22-21-23(2)3/h5,8-9H,1,6-7,12-22H2,2-4H3 |
| InChIKey | BEAAYBKNZRZIKT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|