C19H31NO — CID 171119784
2-[[(Z)-hexadec-13-en-9,11-diynyl]-methylamino]ethanol (PubChem CID 171119784) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 2-[[(Z)-hexadec-13-en-9,11-diynyl]-methylamino]ethanol.
| Compound Name | 2-[[(Z)-hexadec-13-en-9,11-diynyl]-methylamino]ethanol |
|---|---|
| PubChem CID | 171119784 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 2-[[(Z)-hexadec-13-en-9,11-diynyl]-methylamino]ethanol |
| SMILES | CC/C=C\C#CC#CCCCCCCCCN(C)CCO |
| InChI | InChI=1S/C19H31NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(2)18-19-21/h4-5,21H,3,10-19H2,1-2H3/b5-4- |
| InChIKey | FXICUPVRYGKJLQ-PLNGDYQASA-N |
| XLogP | 3.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|