C20H39N3 — CID 123959167
7-N-(1-amino-2-methylpropyl)-6-ethylidene-1-N,8-dimethyl-2-methylideneundec-9-ene-1,7-diamine (PubChem CID 123959167) has the molecular formula C20H39N3 and a molecular weight of 321.55 g/mol. Its IUPAC name is 7-N-(1-amino-2-methylpropyl)-6-ethylidene-1-N,8-dimethyl-2-methylideneundec-9-ene-1,7-diamine.
| Compound Name | 7-N-(1-amino-2-methylpropyl)-6-ethylidene-1-N,8-dimethyl-2-methylideneundec-9-ene-1,7-diamine |
|---|---|
| PubChem CID | 123959167 |
| Molecular Formula | C20H39N3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.31 |
| IUPAC Name | 7-N-(1-amino-2-methylpropyl)-6-ethylidene-1-N,8-dimethyl-2-methylideneundec-9-ene-1,7-diamine |
| SMILES | C=C(CCCC(=CC)C(NC(N)C(C)C)C(C)C=CC)CNC |
| InChI | InChI=1S/C20H39N3/c1-8-11-17(6)19(23-20(21)15(3)4)18(9-2)13-10-12-16(5)14-22-7/h8-9,11,15,17,19-20,22-23H,5,10,12-14,21H2,1-4,6-7H3 |
| InChIKey | XZRSBPOXAQWKFU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|